C13H24N4 — CID 142912091
2-[4-[(2E,4Z)-hepta-2,4-dien-2-yl]piperazin-1-yl]ethanimidamide (PubChem CID 142912091) has the molecular formula C13H24N4 and a molecular weight of 236.36 g/mol. Its IUPAC name is 2-[4-[(2E,4Z)-hepta-2,4-dien-2-yl]piperazin-1-yl]ethanimidamide.
| Compound Name | 2-[4-[(2E,4Z)-hepta-2,4-dien-2-yl]piperazin-1-yl]ethanimidamide |
|---|---|
| PubChem CID | 142912091 |
| Molecular Formula | C13H24N4 |
| Molecular Weight | 236.36 g/mol |
| Exact Mass | 236.20 |
| IUPAC Name | 2-[4-[(2E,4Z)-hepta-2,4-dien-2-yl]piperazin-1-yl]ethanimidamide |
| SMILES | [H]/N=C(\N)CN1CCN(/C(C)=C/C=C\CC)CC1 |
| InChI | InChI=1S/C13H24N4/c1-3-4-5-6-12(2)17-9-7-16(8-10-17)11-13(14)15/h4-6H,3,7-11H2,1-2H3,(H3,14,15)/b5-4-,12-6+ |
| InChIKey | KNRFRWRERAZWRG-QENXGIAESA-N |
| XLogP | 1.41 |
| TPSA | 56.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.36 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|