C26H36N4 — CID 143346526
(3Z)-2-N-but-3-enyl-6-N-[(2E,4Z)-2-ethenyl-4-methylhexa-2,4-dienyl]-5-methylidene-3-(2-methyl-5-methylidene-4H-imidazol-1-yl)hepta-1,3,6-triene-2,6-diamine (PubChem CID 143346526) has the molecular formula C26H36N4 and a molecular weight of 404.60 g/mol. Its IUPAC name is (3Z)-2-N-but-3-enyl-6-N-[(2E,4Z)-2-ethenyl-4-methylhexa-2,4-dienyl]-5-methylidene-3-(2-methyl-5-methylidene-4H-imidazol-1-yl)hepta-1,3,6-triene-2,6-diamine.
| Compound Name | (3Z)-2-N-but-3-enyl-6-N-[(2E,4Z)-2-ethenyl-4-methylhexa-2,4-dienyl]-5-methylidene-3-(2-methyl-5-methylidene-4H-imidazol-1-yl)hepta-1,3,6-triene-2,6-diamine |
|---|---|
| PubChem CID | 143346526 |
| Molecular Formula | C26H36N4 |
| Molecular Weight | 404.60 g/mol |
| Exact Mass | 404.29 |
| IUPAC Name | (3Z)-2-N-but-3-enyl-6-N-[(2E,4Z)-2-ethenyl-4-methylhexa-2,4-dienyl]-5-methylidene-3-(2-methyl-5-methylidene-4H-imidazol-1-yl)hepta-1,3,6-triene-2,6-diamine |
| SMILES | C=CCCNC(=C)/C(=C/C(=C)C(=C)NC/C(C=C)=C/C(C)=C\C)N1C(=C)CN=C1C |
| InChI | InChI=1S/C26H36N4/c1-10-13-14-27-23(8)26(30-21(6)17-29-24(30)9)16-20(5)22(7)28-18-25(12-3)15-19(4)11-2/h10-12,15-16,27-28H,1,3,5-8,13-14,17-18H2,2,4,9H3/b19-11-,25-15+,26-16- |
| InChIKey | HQHRCRCHHGSVFN-BSKLSVENSA-N |
| XLogP | 5.54 |
| TPSA | 39.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.60 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|