C20H39N3 — CID 142133887
N-[(1-heptan-4-yl-5-methylidene-4H-imidazol-2-yl)methyl]propan-2-amine;(Z)-pent-2-ene (PubChem CID 142133887) has the molecular formula C20H39N3 and a molecular weight of 321.55 g/mol. Its IUPAC name is N-[(1-heptan-4-yl-5-methylidene-4H-imidazol-2-yl)methyl]propan-2-amine;(Z)-pent-2-ene.
| Compound Name | N-[(1-heptan-4-yl-5-methylidene-4H-imidazol-2-yl)methyl]propan-2-amine;(Z)-pent-2-ene |
|---|---|
| PubChem CID | 142133887 |
| Molecular Formula | C20H39N3 |
| Molecular Weight | 321.55 g/mol |
| Exact Mass | 321.31 |
| IUPAC Name | N-[(1-heptan-4-yl-5-methylidene-4H-imidazol-2-yl)methyl]propan-2-amine;(Z)-pent-2-ene |
| SMILES | C/C=C\CC.C=C1CN=C(CNC(C)C)N1C(CCC)CCC |
| InChI | InChI=1S/C15H29N3.C5H10/c1-6-8-14(9-7-2)18-13(5)10-17-15(18)11-16-12(3)4;1-3-5-4-2/h12,14,16H,5-11H2,1-4H3;3,5H,4H2,1-2H3/b;5-3- |
| InChIKey | MBPPISVNURCYNA-PJAIOPLOSA-N |
| XLogP | 5.15 |
| TPSA | 27.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.55 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|