C20H29N3 — CID 143957809
ethane;3-ethenyl-7-methyl-2-(4-methylpiperazin-1-yl)-6H-cyclohepta[b]pyridine (PubChem CID 143957809) has the molecular formula C20H29N3 and a molecular weight of 311.47 g/mol. Its IUPAC name is ethane;3-ethenyl-7-methyl-2-(4-methylpiperazin-1-yl)-6H-cyclohepta[b]pyridine.
| Compound Name | ethane;3-ethenyl-7-methyl-2-(4-methylpiperazin-1-yl)-6H-cyclohepta[b]pyridine |
|---|---|
| PubChem CID | 143957809 |
| Molecular Formula | C20H29N3 |
| Molecular Weight | 311.47 g/mol |
| Exact Mass | 311.24 |
| IUPAC Name | ethane;3-ethenyl-7-methyl-2-(4-methylpiperazin-1-yl)-6H-cyclohepta[b]pyridine |
| SMILES | C=Cc1cc2c(nc1N1CCN(C)CC1)=CC=C(C)CC=2.CC |
| InChI | InChI=1S/C18H23N3.C2H6/c1-4-15-13-16-7-5-14(2)6-8-17(16)19-18(15)21-11-9-20(3)10-12-21;1-2/h4,6-8,13H,1,5,9-12H2,2-3H3;1-2H3 |
| InChIKey | CSWBHDGJDZZHDG-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 19.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.47 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |