C23H33N3 — CID 126495587
(Z)-1-[4-[(2E,4E,6E)-2,6-bis(ethenyl)-5-methylocta-2,4,6-trienyl]piperazin-1-yl]-N-ethenylbut-2-en-1-imine (PubChem CID 126495587) has the molecular formula C23H33N3 and a molecular weight of 351.54 g/mol. Its IUPAC name is (Z)-1-[4-[(2E,4E,6E)-2,6-bis(ethenyl)-5-methylocta-2,4,6-trienyl]piperazin-1-yl]-N-ethenylbut-2-en-1-imine.
| Compound Name | (Z)-1-[4-[(2E,4E,6E)-2,6-bis(ethenyl)-5-methylocta-2,4,6-trienyl]piperazin-1-yl]-N-ethenylbut-2-en-1-imine |
|---|---|
| PubChem CID | 126495587 |
| Molecular Formula | C23H33N3 |
| Molecular Weight | 351.54 g/mol |
| Exact Mass | 351.27 |
| IUPAC Name | (Z)-1-[4-[(2E,4E,6E)-2,6-bis(ethenyl)-5-methylocta-2,4,6-trienyl]piperazin-1-yl]-N-ethenylbut-2-en-1-imine |
| SMILES | C=C/N=C(\C=C/C)N1CCN(C/C(C=C)=C/C=C(C)/C(C=C)=C/C)CC1 |
| InChI | InChI=1S/C23H33N3/c1-7-12-23(24-11-5)26-17-15-25(16-18-26)19-21(8-2)14-13-20(6)22(9-3)10-4/h7-14H,2-3,5,15-19H2,1,4,6H3/b12-7-,20-13+,21-14+,22-10+,24-23+ |
| InChIKey | QRIATIVEQGEZIU-XYUYCWADSA-N |
| XLogP | 4.91 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.54 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|