C25H35N3 — CID 126495651
(Z)-N-ethenyl-1-[4-[(2E,4E,6E,8Z)-2-ethenyl-5,6-dimethylundeca-2,4,6,8,10-pentaenyl]piperazin-1-yl]but-2-en-1-imine (PubChem CID 126495651) has the molecular formula C25H35N3 and a molecular weight of 377.58 g/mol. Its IUPAC name is (Z)-N-ethenyl-1-[4-[(2E,4E,6E,8Z)-2-ethenyl-5,6-dimethylundeca-2,4,6,8,10-pentaenyl]piperazin-1-yl]but-2-en-1-imine.
| Compound Name | (Z)-N-ethenyl-1-[4-[(2E,4E,6E,8Z)-2-ethenyl-5,6-dimethylundeca-2,4,6,8,10-pentaenyl]piperazin-1-yl]but-2-en-1-imine |
|---|---|
| PubChem CID | 126495651 |
| Molecular Formula | C25H35N3 |
| Molecular Weight | 377.58 g/mol |
| Exact Mass | 377.28 |
| IUPAC Name | (Z)-N-ethenyl-1-[4-[(2E,4E,6E,8Z)-2-ethenyl-5,6-dimethylundeca-2,4,6,8,10-pentaenyl]piperazin-1-yl]but-2-en-1-imine |
| SMILES | C=C/C=C\C=C(C)\C(C)=C\C=C(/C=C)CN1CCN(C(/C=C\C)=N/C=C)CC1 |
| InChI | InChI=1S/C25H35N3/c1-7-11-12-14-22(5)23(6)15-16-24(9-3)21-27-17-19-28(20-18-27)25(13-8-2)26-10-4/h7-16H,1,3-4,17-21H2,2,5-6H3/b12-11-,13-8-,22-14+,23-15+,24-16+,26-25+ |
| InChIKey | UGEPCKLKCLNNCB-UUQIIKTDSA-N |
| XLogP | 5.47 |
| TPSA | 18.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.58 |
| LogP ≤ 5 | 5.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|