C16H22N4 — CID 143096898
N,N-dimethyl-1-piperazin-1-yl-8H-cyclohepta[c]pyridin-7-amine (PubChem CID 143096898) has the molecular formula C16H22N4 and a molecular weight of 270.38 g/mol. Its IUPAC name is N,N-dimethyl-1-piperazin-1-yl-8H-cyclohepta[c]pyridin-7-amine.
| Compound Name | N,N-dimethyl-1-piperazin-1-yl-8H-cyclohepta[c]pyridin-7-amine |
|---|---|
| PubChem CID | 143096898 |
| Molecular Formula | C16H22N4 |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | N,N-dimethyl-1-piperazin-1-yl-8H-cyclohepta[c]pyridin-7-amine |
| SMILES | CN(C)C1=CC=c2ccnc(N3CCNCC3)c2=CC1 |
| InChI | InChI=1S/C16H22N4/c1-19(2)14-4-3-13-7-8-18-16(15(13)6-5-14)20-11-9-17-10-12-20/h3-4,6-8,17H,5,9-12H2,1-2H3 |
| InChIKey | CZZOFXKZEPLHKQ-UHFFFAOYSA-N |
| XLogP | -0.10 |
| TPSA | 31.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |