C12H17N3 — CID 123234443
1-(4-methyl-5,6-dimethylidene-2-pyridinyl)piperazine (PubChem CID 123234443) has the molecular formula C12H17N3 and a molecular weight of 203.29 g/mol. Its IUPAC name is 1-(4-methyl-5,6-dimethylidene-2-pyridinyl)piperazine.
| Compound Name | 1-(4-methyl-5,6-dimethylidene-2-pyridinyl)piperazine |
|---|---|
| PubChem CID | 123234443 |
| Molecular Formula | C12H17N3 |
| Molecular Weight | 203.29 g/mol |
| Exact Mass | 203.14 |
| IUPAC Name | 1-(4-methyl-5,6-dimethylidene-2-pyridinyl)piperazine |
| SMILES | C=c1nc(N2CCNCC2)cc(C)c1=C |
| InChI | InChI=1S/C12H17N3/c1-9-8-12(14-11(3)10(9)2)15-6-4-13-5-7-15/h8,13H,2-7H2,1H3 |
| InChIKey | UQPLEBVYMGGWCF-UHFFFAOYSA-N |
| XLogP | -0.38 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.29 |
| LogP ≤ 5 | -0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |