C18H30N4 — CID 142345339
(2E)-1-(C,N-dimethylcarbonimidoyl)-5-methyl-N-(1-methylpiperidin-4-yl)-2-propylidenepyridin-3-amine (PubChem CID 142345339) has the molecular formula C18H30N4 and a molecular weight of 302.47 g/mol. Its IUPAC name is (2E)-1-(C,N-dimethylcarbonimidoyl)-5-methyl-N-(1-methylpiperidin-4-yl)-2-propylidenepyridin-3-amine.
| Compound Name | (2E)-1-(C,N-dimethylcarbonimidoyl)-5-methyl-N-(1-methylpiperidin-4-yl)-2-propylidenepyridin-3-amine |
|---|---|
| PubChem CID | 142345339 |
| Molecular Formula | C18H30N4 |
| Molecular Weight | 302.47 g/mol |
| Exact Mass | 302.25 |
| IUPAC Name | (2E)-1-(C,N-dimethylcarbonimidoyl)-5-methyl-N-(1-methylpiperidin-4-yl)-2-propylidenepyridin-3-amine |
| SMILES | CC/C=C1\C(NC2CCN(C)CC2)=CC(C)=CN1/C(C)=N/C |
| InChI | InChI=1S/C18H30N4/c1-6-7-18-17(20-16-8-10-21(5)11-9-16)12-14(2)13-22(18)15(3)19-4/h7,12-13,16,20H,6,8-11H2,1-5H3/b18-7+,19-15+ |
| InChIKey | AFMGDAIVCBVMFY-GZDKYGJJSA-N |
| XLogP | 3.12 |
| TPSA | 30.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.47 |
| LogP ≤ 5 | 3.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|