C14H25N5 — CID 91305367
7-ethyl-2-piperazin-1-yl-4,4a,5,6,7,8-hexahydro-3H-pyrazino[2,3-c]azepine (PubChem CID 91305367) has the molecular formula C14H25N5 and a molecular weight of 263.39 g/mol. Its IUPAC name is 7-ethyl-2-piperazin-1-yl-4,4a,5,6,7,8-hexahydro-3H-pyrazino[2,3-c]azepine.
| Compound Name | 7-ethyl-2-piperazin-1-yl-4,4a,5,6,7,8-hexahydro-3H-pyrazino[2,3-c]azepine |
|---|---|
| PubChem CID | 91305367 |
| Molecular Formula | C14H25N5 |
| Molecular Weight | 263.39 g/mol |
| Exact Mass | 263.21 |
| IUPAC Name | 7-ethyl-2-piperazin-1-yl-4,4a,5,6,7,8-hexahydro-3H-pyrazino[2,3-c]azepine |
| SMILES | CCC1CC=C2N=C(N3CCNCC3)CNC2CN1 |
| InChI | InChI=1S/C14H25N5/c1-2-11-3-4-12-13(9-16-11)17-10-14(18-12)19-7-5-15-6-8-19/h4,11,13,15-17H,2-3,5-10H2,1H3 |
| InChIKey | QVUWFSHMAQEUNC-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 51.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.39 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |