C15H28N5+ — CID 126627493
1-[(2S)-5,6-dimethyl-1,2-dihydropyridin-2-yl]-2-(4,4-dimethylpiperazin-4-ium-1-yl)-2-iminoethanamine (PubChem CID 126627493) has the molecular formula C15H28N5+ and a molecular weight of 278.42 g/mol. Its IUPAC name is 1-[(2S)-5,6-dimethyl-1,2-dihydropyridin-2-yl]-2-(4,4-dimethylpiperazin-4-ium-1-yl)-2-iminoethanamine.
| Compound Name | 1-[(2S)-5,6-dimethyl-1,2-dihydropyridin-2-yl]-2-(4,4-dimethylpiperazin-4-ium-1-yl)-2-iminoethanamine |
|---|---|
| PubChem CID | 126627493 |
| Molecular Formula | C15H28N5+ |
| Molecular Weight | 278.42 g/mol |
| Exact Mass | 278.23 |
| IUPAC Name | 1-[(2S)-5,6-dimethyl-1,2-dihydropyridin-2-yl]-2-(4,4-dimethylpiperazin-4-ium-1-yl)-2-iminoethanamine |
| SMILES | [H]/N=C(/C(N)[C@@H]1C=CC(C)=C(C)N1)N1CC[N+](C)(C)CC1 |
| InChI | InChI=1S/C15H28N5/c1-11-5-6-13(18-12(11)2)14(16)15(17)19-7-9-20(3,4)10-8-19/h5-6,13-14,17-18H,7-10,16H2,1-4H3/q+1/b17-15-/t13-,14?/m0/s1 |
| InChIKey | FZDDBVQJDKDPDR-LECIAWHCSA-N |
| XLogP | 0.50 |
| TPSA | 65.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.42 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|