C15H19ClN4 — CID 143245107
3-chloro-11-methyl-5-piperazin-1-yl-2,4-diazabicyclo[5.5.0]dodeca-1(12),2,4,7,10-pentaene (PubChem CID 143245107) has the molecular formula C15H19ClN4 and a molecular weight of 290.80 g/mol. Its IUPAC name is 3-chloro-11-methyl-5-piperazin-1-yl-2,4-diazabicyclo[5.5.0]dodeca-1(12),2,4,7,10-pentaene.
| Compound Name | 3-chloro-11-methyl-5-piperazin-1-yl-2,4-diazabicyclo[5.5.0]dodeca-1(12),2,4,7,10-pentaene |
|---|---|
| PubChem CID | 143245107 |
| Molecular Formula | C15H19ClN4 |
| Molecular Weight | 290.80 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 3-chloro-11-methyl-5-piperazin-1-yl-2,4-diazabicyclo[5.5.0]dodeca-1(12),2,4,7,10-pentaene |
| SMILES | CC1=CCC=C2CC(N3CCNCC3)=NC(Cl)=NC2=C1 |
| InChI | InChI=1S/C15H19ClN4/c1-11-3-2-4-12-10-14(20-7-5-17-6-8-20)19-15(16)18-13(12)9-11/h3-4,9,17H,2,5-8,10H2,1H3 |
| InChIKey | WNAJFUIGBGLUJB-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 39.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.80 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|