About 1-but-1-en-2-yl-5-(3,3-dimethylpiperazin-1-yl)-3-methylpyridin-2-imine
1-but-1-en-2-yl-5-(3,3-dimethylpiperazin-1-yl)-3-methylpyridin-2-imine (PubChem CID 123733887) has the molecular formula C16H26N4
and a molecular weight of 274.41 g/mol. Its IUPAC name is 1-but-1-en-2-yl-5-(3,3-dimethylpiperazin-1-yl)-3-methylpyridin-2-imine.
Molecular Properties
| Compound Name | 1-but-1-en-2-yl-5-(3,3-dimethylpiperazin-1-yl)-3-methylpyridin-2-imine |
| PubChem CID | 123733887 |
| Molecular Formula | C16H26N4 |
| Molecular Weight | 274.41 g/mol |
| Exact Mass | 274.22 |
| IUPAC Name | 1-but-1-en-2-yl-5-(3,3-dimethylpiperazin-1-yl)-3-methylpyridin-2-imine |
| SMILES | [H]/N=c1\c(C)cc(N2CCNC(C)(C)C2)cn1C(=C)CC |
| InChI | InChI=1S/C16H26N4/c1-6-13(3)20-10-14(9-12(2)15(20)17)19-8-7-18-16(4,5)11-19/h9-10,17-18H,3,6-8,11H2,1-2,4-5H3/b17-15+ |
| InChIKey | YLNCRRLWIQCJAR-BMRADRMJSA-N |
| XLogP | 2.34 |
| TPSA | 44.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.41 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-but-1-en-2-yl-5-(3,3-dimethylpiperazin-1-yl)-3-methylpyridin-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-but-1-en-2-yl-5-(3,3-dimethylpiperazin-1-yl)-3-methylpyridin-2-imine?
The IUPAC name of 1-but-1-en-2-yl-5-(3,3-dimethylpiperazin-1-yl)-3-methylpyridin-2-imine (CID 123733887) is 1-but-1-en-2-yl-5-(3,3-dimethylpiperazin-1-yl)-3-methylpyridin-2-imine.
What is the SMILES notation for 1-but-1-en-2-yl-5-(3,3-dimethylpiperazin-1-yl)-3-methylpyridin-2-imine?
The canonical SMILES for 1-but-1-en-2-yl-5-(3,3-dimethylpiperazin-1-yl)-3-methylpyridin-2-imine is [H]/N=c1\c(C)cc(N2CCNC(C)(C)C2)cn1C(=C)CC.
What is the InChIKey of 1-but-1-en-2-yl-5-(3,3-dimethylpiperazin-1-yl)-3-methylpyridin-2-imine?
The InChIKey is YLNCRRLWIQCJAR-BMRADRMJSA-N. The full InChI is InChI=1S/C16H26N4/c1-6-13(3)20-10-14(9-12(2)15(20)17)19-8-7-18-16(4,5)11-19/h9-10,17-18H,3,6-8,11H2,1-2,4-5H3/b17-15+.
What are the key properties of 1-but-1-en-2-yl-5-(3,3-dimethylpiperazin-1-yl)-3-methylpyridin-2-imine?
1-but-1-en-2-yl-5-(3,3-dimethylpiperazin-1-yl)-3-methylpyridin-2-imine has a molecular weight of 274.41 g/mol, XLogP of 2.34, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-but-1-en-2-yl-5-(3,3-dimethylpiperazin-1-yl)-3-methylpyridin-2-imine is sourced from PubChem (CID 123733887), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).