C32H49N5 — CID 142511432
(Z)-3,4-dimethyloct-4-ene;(2E)-1-[7-(3,5-dimethylpiperazin-1-yl)-4-methylidenepyrido[1,2-a]pyrimidin-2-yl]-N,3-dimethylpenta-2,4-dien-1-imine (PubChem CID 142511432) has the molecular formula C32H49N5 and a molecular weight of 503.78 g/mol. Its IUPAC name is (Z)-3,4-dimethyloct-4-ene;(2E)-1-[7-(3,5-dimethylpiperazin-1-yl)-4-methylidenepyrido[1,2-a]pyrimidin-2-yl]-N,3-dimethylpenta-2,4-dien-1-imine.
| Compound Name | (Z)-3,4-dimethyloct-4-ene;(2E)-1-[7-(3,5-dimethylpiperazin-1-yl)-4-methylidenepyrido[1,2-a]pyrimidin-2-yl]-N,3-dimethylpenta-2,4-dien-1-imine |
|---|---|
| PubChem CID | 142511432 |
| Molecular Formula | C32H49N5 |
| Molecular Weight | 503.78 g/mol |
| Exact Mass | 503.40 |
| IUPAC Name | (Z)-3,4-dimethyloct-4-ene;(2E)-1-[7-(3,5-dimethylpiperazin-1-yl)-4-methylidenepyrido[1,2-a]pyrimidin-2-yl]-N,3-dimethylpenta-2,4-dien-1-imine |
| SMILES | C=C/C(C)=C/C(=N\C)C1=CC(=C)N2C=C(N3CC(C)NC(C)C3)C=CC2=N1.CCC/C=C(/C)C(C)CC |
| InChI | InChI=1S/C22H29N5.C10H20/c1-7-15(2)10-20(23-6)21-11-18(5)27-14-19(8-9-22(27)25-21)26-12-16(3)24-17(4)13-26;1-5-7-8-10(4)9(3)6-2/h7-11,14,16-17,24H,1,5,12-13H2,2-4,6H3;8-9H,5-7H2,1-4H3/b15-10+,23-20+;10-8- |
| InChIKey | BHYUWSBQKQWXJR-KXZMGTCJSA-N |
| XLogP | 7.17 |
| TPSA | 43.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.78 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|