C25H24F4N5O4+ — CID 123900845
13-(4-fluorophenyl)-4-(4-hydroxyoxane-4-carbonyl)-2-methyl-15-(trifluoromethyl)-4,7,11,12-tetraza-1-azoniatetracyclo[7.7.0.02,7.011,16]hexadeca-1(16),9,12,14-tetraen-8-one (PubChem CID 123900845) has the molecular formula C25H24F4N5O4+ and a molecular weight of 534.49 g/mol. Its IUPAC name is 13-(4-fluorophenyl)-4-(4-hydroxyoxane-4-carbonyl)-2-methyl-15-(trifluoromethyl)-4,7,11,12-tetraza-1-azoniatetracyclo[7.7.0.02,7.011,16]hexadeca-1(16),9,12,14-tetraen-8-one.
| Compound Name | 13-(4-fluorophenyl)-4-(4-hydroxyoxane-4-carbonyl)-2-methyl-15-(trifluoromethyl)-4,7,11,12-tetraza-1-azoniatetracyclo[7.7.0.02,7.011,16]hexadeca-1(16),9,12,14-tetraen-8-one |
|---|---|
| PubChem CID | 123900845 |
| Molecular Formula | C25H24F4N5O4+ |
| Molecular Weight | 534.49 g/mol |
| Exact Mass | 534.18 |
| IUPAC Name | 13-(4-fluorophenyl)-4-(4-hydroxyoxane-4-carbonyl)-2-methyl-15-(trifluoromethyl)-4,7,11,12-tetraza-1-azoniatetracyclo[7.7.0.02,7.011,16]hexadeca-1(16),9,12,14-tetraen-8-one |
| SMILES | CC12CN(C(=O)C3(O)CCOCC3)CCN1C(=O)c1cn3nc(-c4ccc(F)cc4)cc(C(F)(F)F)c3[n+]12 |
| InChI | InChI=1S/C25H24F4N5O4/c1-23-14-31(22(36)24(37)6-10-38-11-7-24)8-9-32(23)21(35)19-13-33-20(34(19)23)17(25(27,28)29)12-18(30-33)15-2-4-16(26)5-3-15/h2-5,12-13,37H,6-11,14H2,1H3/q+1 |
| InChIKey | BONRUOQJBFPHJL-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 91.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.49 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|