C24H36N8O8S2 — CID 123902818
[3-[[2-(2-amino-1,3-thiazol-4-yl)-2-[1-[4-[N'-[2-(methylamino)ethyl]carbamimidoyl]phenoxy]propan-2-yloxyimino]acetyl]amino]-2-hydroxy-2,4,4-trimethylazetidin-1-yl] hydrogen sulfate (PubChem CID 123902818) has the molecular formula C24H36N8O8S2 and a molecular weight of 628.73 g/mol. Its IUPAC name is [3-[[2-(2-amino-1,3-thiazol-4-yl)-2-[1-[4-[N'-[2-(methylamino)ethyl]carbamimidoyl]phenoxy]propan-2-yloxyimino]acetyl]amino]-2-hydroxy-2,4,4-trimethylazetidin-1-yl] hydrogen sulfate.
| Compound Name | [3-[[2-(2-amino-1,3-thiazol-4-yl)-2-[1-[4-[N'-[2-(methylamino)ethyl]carbamimidoyl]phenoxy]propan-2-yloxyimino]acetyl]amino]-2-hydroxy-2,4,4-trimethylazetidin-1-yl] hydrogen sulfate |
|---|---|
| PubChem CID | 123902818 |
| Molecular Formula | C24H36N8O8S2 |
| Molecular Weight | 628.73 g/mol |
| Exact Mass | 628.21 |
| IUPAC Name | [3-[[2-(2-amino-1,3-thiazol-4-yl)-2-[1-[4-[N'-[2-(methylamino)ethyl]carbamimidoyl]phenoxy]propan-2-yloxyimino]acetyl]amino]-2-hydroxy-2,4,4-trimethylazetidin-1-yl] hydrogen sulfate |
| SMILES | CNCC/N=C(\N)c1ccc(OCC(C)ON=C(C(=O)NC2C(C)(C)N(OS(=O)(=O)O)C2(C)O)c2csc(N)n2)cc1 |
| InChI | InChI=1S/C24H36N8O8S2/c1-14(12-38-16-8-6-15(7-9-16)19(25)28-11-10-27-5)39-31-18(17-13-41-22(26)29-17)20(33)30-21-23(2,3)32(24(21,4)34)40-42(35,36)37/h6-9,13-14,21,27,34H,10-12H2,1-5H3,(H2,25,28)(H2,26,29)(H,30,33)(H,35,36,37) |
| InChIKey | KFWSATLERICAHJ-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 236.31 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 42 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.73 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|