C51H44N4O — CID 123902987
5-[2-(4-cyclohexa-1,3-dien-1-yl-6-phenyl-1,3,5-triazin-2-yl)-11,11,12,12-tetramethylindeno[2,1-a]fluoren-9-yl]-8-propoxyquinoline (PubChem CID 123902987) has the molecular formula C51H44N4O and a molecular weight of 728.94 g/mol. Its IUPAC name is 5-[2-(4-cyclohexa-1,3-dien-1-yl-6-phenyl-1,3,5-triazin-2-yl)-11,11,12,12-tetramethylindeno[2,1-a]fluoren-9-yl]-8-propoxyquinoline.
| Compound Name | 5-[2-(4-cyclohexa-1,3-dien-1-yl-6-phenyl-1,3,5-triazin-2-yl)-11,11,12,12-tetramethylindeno[2,1-a]fluoren-9-yl]-8-propoxyquinoline |
|---|---|
| PubChem CID | 123902987 |
| Molecular Formula | C51H44N4O |
| Molecular Weight | 728.94 g/mol |
| Exact Mass | 728.35 |
| IUPAC Name | 5-[2-(4-cyclohexa-1,3-dien-1-yl-6-phenyl-1,3,5-triazin-2-yl)-11,11,12,12-tetramethylindeno[2,1-a]fluoren-9-yl]-8-propoxyquinoline |
| SMILES | CCCOc1ccc(-c2ccc3c(c2)C(C)(C)c2c-3ccc3c2C(C)(C)c2cc(-c4nc(C5=CC=CCC5)nc(-c5ccccc5)n4)ccc2-3)c2cccnc12 |
| InChI | InChI=1S/C51H44N4O/c1-6-28-56-43-26-25-35(40-18-13-27-52-46(40)43)33-19-21-36-38-23-24-39-37-22-20-34(30-42(37)51(4,5)45(39)44(38)50(2,3)41(36)29-33)49-54-47(31-14-9-7-10-15-31)53-48(55-49)32-16-11-8-12-17-32/h7-11,13-16,18-27,29-30H,6,12,17,28H2,1-5H3 |
| InChIKey | CQSVFPPIXAOVGE-UHFFFAOYSA-N |
| XLogP | 12.56 |
| TPSA | 60.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 728.94 |
| LogP ≤ 5 | 12.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |