C23H24FNO2 — CID 123903818
3-[2-fluoro-4-[3-[(propan-2-ylamino)methyl]naphthalen-1-yl]phenyl]propanoic acid (PubChem CID 123903818) has the molecular formula C23H24FNO2 and a molecular weight of 365.45 g/mol. Its IUPAC name is 3-[2-fluoro-4-[3-[(propan-2-ylamino)methyl]naphthalen-1-yl]phenyl]propanoic acid.
| Compound Name | 3-[2-fluoro-4-[3-[(propan-2-ylamino)methyl]naphthalen-1-yl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 123903818 |
| Molecular Formula | C23H24FNO2 |
| Molecular Weight | 365.45 g/mol |
| Exact Mass | 365.18 |
| IUPAC Name | 3-[2-fluoro-4-[3-[(propan-2-ylamino)methyl]naphthalen-1-yl]phenyl]propanoic acid |
| SMILES | CC(C)NCc1cc(-c2ccc(CCC(=O)O)c(F)c2)c2ccccc2c1 |
| InChI | InChI=1S/C23H24FNO2/c1-15(2)25-14-16-11-18-5-3-4-6-20(18)21(12-16)19-8-7-17(22(24)13-19)9-10-23(26)27/h3-8,11-13,15,25H,9-10,14H2,1-2H3,(H,26,27) |
| InChIKey | ULBMFTKZHGLUDE-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.45 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |