C31H48N2O8 — CID 123904812
[5-[[6-[5-[4-hydroxy-7-[2-oxo-2-(propylamino)ethyl]-1,6-dioxaspiro[2.5]octan-5-yl]-3-methylpenta-2,4-dienyl]-2,5-dimethyloxan-3-yl]amino]-5-oxopent-3-en-2-yl] acetate (PubChem CID 123904812) has the molecular formula C31H48N2O8 and a molecular weight of 576.73 g/mol. Its IUPAC name is [5-[[6-[5-[4-hydroxy-7-[2-oxo-2-(propylamino)ethyl]-1,6-dioxaspiro[2.5]octan-5-yl]-3-methylpenta-2,4-dienyl]-2,5-dimethyloxan-3-yl]amino]-5-oxopent-3-en-2-yl] acetate.
| Compound Name | [5-[[6-[5-[4-hydroxy-7-[2-oxo-2-(propylamino)ethyl]-1,6-dioxaspiro[2.5]octan-5-yl]-3-methylpenta-2,4-dienyl]-2,5-dimethyloxan-3-yl]amino]-5-oxopent-3-en-2-yl] acetate |
|---|---|
| PubChem CID | 123904812 |
| Molecular Formula | C31H48N2O8 |
| Molecular Weight | 576.73 g/mol |
| Exact Mass | 576.34 |
| IUPAC Name | [5-[[6-[5-[4-hydroxy-7-[2-oxo-2-(propylamino)ethyl]-1,6-dioxaspiro[2.5]octan-5-yl]-3-methylpenta-2,4-dienyl]-2,5-dimethyloxan-3-yl]amino]-5-oxopent-3-en-2-yl] acetate |
| SMILES | CCCNC(=O)CC1CC2(CO2)C(O)C(C=CC(C)=CCC2OC(C)C(NC(=O)C=CC(C)OC(C)=O)CC2C)O1 |
| InChI | InChI=1S/C31H48N2O8/c1-7-14-32-29(36)16-24-17-31(18-38-31)30(37)27(41-24)12-9-19(2)8-11-26-20(3)15-25(22(5)40-26)33-28(35)13-10-21(4)39-23(6)34/h8-10,12-13,20-22,24-27,30,37H,7,11,14-18H2,1-6H3,(H,32,36)(H,33,35) |
| InChIKey | LNDYONFBBRPUCV-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 135.72 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.73 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|