C28H43NO7 — CID 134550048
[(Z)-5-[[6-[(2E,4E)-5-[(4R,7R)-7-ethyl-4-hydroxy-1,6-dioxaspiro[2.5]octan-5-yl]-3-methylpenta-2,4-dienyl]-2,5-dimethyloxan-3-yl]amino]-5-oxopent-3-en-2-yl] acetate (PubChem CID 134550048) has the molecular formula C28H43NO7 and a molecular weight of 505.65 g/mol. Its IUPAC name is [(Z)-5-[[6-[(2E,4E)-5-[(4R,7R)-7-ethyl-4-hydroxy-1,6-dioxaspiro[2.5]octan-5-yl]-3-methylpenta-2,4-dienyl]-2,5-dimethyloxan-3-yl]amino]-5-oxopent-3-en-2-yl] acetate.
| Compound Name | [(Z)-5-[[6-[(2E,4E)-5-[(4R,7R)-7-ethyl-4-hydroxy-1,6-dioxaspiro[2.5]octan-5-yl]-3-methylpenta-2,4-dienyl]-2,5-dimethyloxan-3-yl]amino]-5-oxopent-3-en-2-yl] acetate |
|---|---|
| PubChem CID | 134550048 |
| Molecular Formula | C28H43NO7 |
| Molecular Weight | 505.65 g/mol |
| Exact Mass | 505.30 |
| IUPAC Name | [(Z)-5-[[6-[(2E,4E)-5-[(4R,7R)-7-ethyl-4-hydroxy-1,6-dioxaspiro[2.5]octan-5-yl]-3-methylpenta-2,4-dienyl]-2,5-dimethyloxan-3-yl]amino]-5-oxopent-3-en-2-yl] acetate |
| SMILES | CC[C@@H]1CC2(CO2)[C@H](O)C(/C=C/C(C)=C/CC2OC(C)C(NC(=O)/C=C\C(C)OC(C)=O)CC2C)O1 |
| InChI | InChI=1S/C28H43NO7/c1-7-22-15-28(16-33-28)27(32)25(36-22)12-9-17(2)8-11-24-18(3)14-23(20(5)35-24)29-26(31)13-10-19(4)34-21(6)30/h8-10,12-13,18-20,22-25,27,32H,7,11,14-16H2,1-6H3,(H,29,31)/b12-9+,13-10-,17-8+/t18?,19?,20?,22-,23?,24?,25?,27-,28?/m1/s1 |
| InChIKey | UPCLZNZJWSSOQN-PSNOVENNSA-N |
| XLogP | 3.38 |
| TPSA | 106.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.65 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|