C10H18N2 — CID 123907392
N-methyl-2-(1-methylpyrrolidin-2-yl)but-2-en-1-imine (PubChem CID 123907392) has the molecular formula C10H18N2 and a molecular weight of 166.27 g/mol. Its IUPAC name is N-methyl-2-(1-methylpyrrolidin-2-yl)but-2-en-1-imine.
| Compound Name | N-methyl-2-(1-methylpyrrolidin-2-yl)but-2-en-1-imine |
|---|---|
| PubChem CID | 123907392 |
| Molecular Formula | C10H18N2 |
| Molecular Weight | 166.27 g/mol |
| Exact Mass | 166.15 |
| IUPAC Name | N-methyl-2-(1-methylpyrrolidin-2-yl)but-2-en-1-imine |
| SMILES | CC=C(/C=N/C)C1CCCN1C |
| InChI | InChI=1S/C10H18N2/c1-4-9(8-11-2)10-6-5-7-12(10)3/h4,8,10H,5-7H2,1-3H3/b9-4?,11-8+ |
| InChIKey | LGSAIOVYPXQSSX-ACZFZUQFSA-N |
| XLogP | 1.73 |
| TPSA | 15.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.27 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|