C13H18N2 — CID 142237370
(2Z,4E)-4-ethynyl-2-[(2S)-1-methylpyrrolidin-2-yl]hexa-2,4-dien-1-imine (PubChem CID 142237370) has the molecular formula C13H18N2 and a molecular weight of 202.30 g/mol. Its IUPAC name is (2Z,4E)-4-ethynyl-2-[(2S)-1-methylpyrrolidin-2-yl]hexa-2,4-dien-1-imine.
| Compound Name | (2Z,4E)-4-ethynyl-2-[(2S)-1-methylpyrrolidin-2-yl]hexa-2,4-dien-1-imine |
|---|---|
| PubChem CID | 142237370 |
| Molecular Formula | C13H18N2 |
| Molecular Weight | 202.30 g/mol |
| Exact Mass | 202.15 |
| IUPAC Name | (2Z,4E)-4-ethynyl-2-[(2S)-1-methylpyrrolidin-2-yl]hexa-2,4-dien-1-imine |
| SMILES | [H]/N=C/C(=C\C(C#C)=C/C)[C@@H]1CCCN1C |
| InChI | InChI=1S/C13H18N2/c1-4-11(5-2)9-12(10-14)13-7-6-8-15(13)3/h1,5,9-10,13-14H,6-8H2,2-3H3/b11-5-,12-9+,14-10+/t13-/m0/s1 |
| InChIKey | VSVPHGURFZZJKI-LHMVPDQTSA-N |
| XLogP | 2.24 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.30 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|