C24H31N3O3 — CID 123907463
1-[3-[(3-amino-2-ethanimidoylphenoxy)methyl]piperidin-1-yl]-2-(4-ethoxyphenyl)ethanone (PubChem CID 123907463) has the molecular formula C24H31N3O3 and a molecular weight of 409.53 g/mol. Its IUPAC name is 1-[3-[(3-amino-2-ethanimidoylphenoxy)methyl]piperidin-1-yl]-2-(4-ethoxyphenyl)ethanone.
| Compound Name | 1-[3-[(3-amino-2-ethanimidoylphenoxy)methyl]piperidin-1-yl]-2-(4-ethoxyphenyl)ethanone |
|---|---|
| PubChem CID | 123907463 |
| Molecular Formula | C24H31N3O3 |
| Molecular Weight | 409.53 g/mol |
| Exact Mass | 409.24 |
| IUPAC Name | 1-[3-[(3-amino-2-ethanimidoylphenoxy)methyl]piperidin-1-yl]-2-(4-ethoxyphenyl)ethanone |
| SMILES | [H]/N=C(\C)c1c(N)cccc1OCC1CCCN(C(=O)Cc2ccc(OCC)cc2)C1 |
| InChI | InChI=1S/C24H31N3O3/c1-3-29-20-11-9-18(10-12-20)14-23(28)27-13-5-6-19(15-27)16-30-22-8-4-7-21(26)24(22)17(2)25/h4,7-12,19,25H,3,5-6,13-16,26H2,1-2H3/b25-17+ |
| InChIKey | OYCAANCYFVNHEM-KOEQRZSOSA-N |
| XLogP | 3.92 |
| TPSA | 88.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.53 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|