C15H27FO2Si — CID 123907743
tert-butyl-[2-[(5-fluorocyclohexa-1,4-dien-1-yl)methoxy]ethoxy]-dimethylsilane (PubChem CID 123907743) has the molecular formula C15H27FO2Si and a molecular weight of 286.46 g/mol. Its IUPAC name is tert-butyl-[2-[(5-fluorocyclohexa-1,4-dien-1-yl)methoxy]ethoxy]-dimethylsilane.
| Compound Name | tert-butyl-[2-[(5-fluorocyclohexa-1,4-dien-1-yl)methoxy]ethoxy]-dimethylsilane |
|---|---|
| PubChem CID | 123907743 |
| Molecular Formula | C15H27FO2Si |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.18 |
| IUPAC Name | tert-butyl-[2-[(5-fluorocyclohexa-1,4-dien-1-yl)methoxy]ethoxy]-dimethylsilane |
| SMILES | CC(C)(C)[Si](C)(C)OCCOCC1=CCC=C(F)C1 |
| InChI | InChI=1S/C15H27FO2Si/c1-15(2,3)19(4,5)18-10-9-17-12-13-7-6-8-14(16)11-13/h7-8H,6,9-12H2,1-5H3 |
| InChIKey | WQVOSVKKQMVAME-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|