C16H32O2Si — CID 11507488
tert-butyl-[(1S)-1-[(2R,6R)-6-ethyl-5-methyl-3,6-dihydro-2H-pyran-2-yl]ethoxy]-dimethylsilane (PubChem CID 11507488) has the molecular formula C16H32O2Si and a molecular weight of 284.52 g/mol. Its IUPAC name is tert-butyl-[(1S)-1-[(2R,6R)-6-ethyl-5-methyl-3,6-dihydro-2H-pyran-2-yl]ethoxy]-dimethylsilane.
| Compound Name | tert-butyl-[(1S)-1-[(2R,6R)-6-ethyl-5-methyl-3,6-dihydro-2H-pyran-2-yl]ethoxy]-dimethylsilane |
|---|---|
| PubChem CID | 11507488 |
| Molecular Formula | C16H32O2Si |
| Molecular Weight | 284.52 g/mol |
| Exact Mass | 284.22 |
| IUPAC Name | tert-butyl-[(1S)-1-[(2R,6R)-6-ethyl-5-methyl-3,6-dihydro-2H-pyran-2-yl]ethoxy]-dimethylsilane |
| SMILES | CC[C@H]1O[C@@H]([C@H](C)O[Si](C)(C)C(C)(C)C)CC=C1C |
| InChI | InChI=1S/C16H32O2Si/c1-9-14-12(2)10-11-15(17-14)13(3)18-19(7,8)16(4,5)6/h10,13-15H,9,11H2,1-8H3/t13-,14+,15+/m0/s1 |
| InChIKey | PGIXQHLBZWGTGO-RRFJBIMHSA-N |
| XLogP | 4.91 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.52 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|