C16H14ClNS — CID 123907895
7-(4-chlorophenyl)-6-ethyl-5-methyl-1,3-benzothiazole (PubChem CID 123907895) has the molecular formula C16H14ClNS and a molecular weight of 287.81 g/mol. Its IUPAC name is 7-(4-chlorophenyl)-6-ethyl-5-methyl-1,3-benzothiazole.
| Compound Name | 7-(4-chlorophenyl)-6-ethyl-5-methyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 123907895 |
| Molecular Formula | C16H14ClNS |
| Molecular Weight | 287.81 g/mol |
| Exact Mass | 287.05 |
| IUPAC Name | 7-(4-chlorophenyl)-6-ethyl-5-methyl-1,3-benzothiazole |
| SMILES | CCc1c(C)cc2ncsc2c1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C16H14ClNS/c1-3-13-10(2)8-14-16(19-9-18-14)15(13)11-4-6-12(17)7-5-11/h4-9H,3H2,1-2H3 |
| InChIKey | ILYKRFIIWPZBOR-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.81 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |