C28H30FN5O2 — CID 123908746
4-[[4-[4-[(3-fluorophenyl)methyl]-3,5-dimethylpiperazin-1-yl]pyrrolo[2,3-b]pyridin-1-yl]methyl]-N-hydroxybenzamide (PubChem CID 123908746) has the molecular formula C28H30FN5O2 and a molecular weight of 487.58 g/mol. Its IUPAC name is 4-[[4-[4-[(3-fluorophenyl)methyl]-3,5-dimethylpiperazin-1-yl]pyrrolo[2,3-b]pyridin-1-yl]methyl]-N-hydroxybenzamide.
| Compound Name | 4-[[4-[4-[(3-fluorophenyl)methyl]-3,5-dimethylpiperazin-1-yl]pyrrolo[2,3-b]pyridin-1-yl]methyl]-N-hydroxybenzamide |
|---|---|
| PubChem CID | 123908746 |
| Molecular Formula | C28H30FN5O2 |
| Molecular Weight | 487.58 g/mol |
| Exact Mass | 487.24 |
| IUPAC Name | 4-[[4-[4-[(3-fluorophenyl)methyl]-3,5-dimethylpiperazin-1-yl]pyrrolo[2,3-b]pyridin-1-yl]methyl]-N-hydroxybenzamide |
| SMILES | CC1CN(c2ccnc3c2ccn3Cc2ccc(C(=O)NO)cc2)CC(C)N1Cc1cccc(F)c1 |
| InChI | InChI=1S/C28H30FN5O2/c1-19-15-33(16-20(2)34(19)18-22-4-3-5-24(29)14-22)26-10-12-30-27-25(26)11-13-32(27)17-21-6-8-23(9-7-21)28(35)31-36/h3-14,19-20,36H,15-18H2,1-2H3,(H,31,35) |
| InChIKey | AHCDTPASNXBUJP-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 73.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.58 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|