C23H39NO — CID 123908755
N-[3-(2-adamantyloxy)propyl]-3,7-dimethylocta-2,6-dien-1-amine (PubChem CID 123908755) has the molecular formula C23H39NO and a molecular weight of 345.57 g/mol. Its IUPAC name is N-[3-(2-adamantyloxy)propyl]-3,7-dimethylocta-2,6-dien-1-amine.
| Compound Name | N-[3-(2-adamantyloxy)propyl]-3,7-dimethylocta-2,6-dien-1-amine |
|---|---|
| PubChem CID | 123908755 |
| Molecular Formula | C23H39NO |
| Molecular Weight | 345.57 g/mol |
| Exact Mass | 345.30 |
| IUPAC Name | N-[3-(2-adamantyloxy)propyl]-3,7-dimethylocta-2,6-dien-1-amine |
| SMILES | CC(C)=CCCC(C)=CCNCCCOC1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C23H39NO/c1-17(2)6-4-7-18(3)8-10-24-9-5-11-25-23-21-13-19-12-20(15-21)16-22(23)14-19/h6,8,19-24H,4-5,7,9-16H2,1-3H3 |
| InChIKey | VAZSUDZWELTYLG-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.57 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|