C19H36N2 — CID 123909804
3-butyl-N,2-diethyl-N,5,6-trimethylocta-2,4-dienimidamide (PubChem CID 123909804) has the molecular formula C19H36N2 and a molecular weight of 292.51 g/mol. Its IUPAC name is 3-butyl-N,2-diethyl-N,5,6-trimethylocta-2,4-dienimidamide.
| Compound Name | 3-butyl-N,2-diethyl-N,5,6-trimethylocta-2,4-dienimidamide |
|---|---|
| PubChem CID | 123909804 |
| Molecular Formula | C19H36N2 |
| Molecular Weight | 292.51 g/mol |
| Exact Mass | 292.29 |
| IUPAC Name | 3-butyl-N,2-diethyl-N,5,6-trimethylocta-2,4-dienimidamide |
| SMILES | [H]/N=C(/C(CC)=C(C=C(C)C(C)CC)CCCC)N(C)CC |
| InChI | InChI=1S/C19H36N2/c1-8-12-13-17(14-16(6)15(5)9-2)18(10-3)19(20)21(7)11-4/h14-15,20H,8-13H2,1-7H3/b16-14?,18-17?,20-19- |
| InChIKey | QPEHJGIQEBZUPU-ABBDUEAISA-N |
| XLogP | 5.80 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.51 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|