C15H29N2+ — CID 123329057
(3-butan-2-yl-2-methylhepta-2,4-dienimidoyl)-trimethylazanium (PubChem CID 123329057) has the molecular formula C15H29N2+ and a molecular weight of 237.41 g/mol. Its IUPAC name is (3-butan-2-yl-2-methylhepta-2,4-dienimidoyl)-trimethylazanium.
| Compound Name | (3-butan-2-yl-2-methylhepta-2,4-dienimidoyl)-trimethylazanium |
|---|---|
| PubChem CID | 123329057 |
| Molecular Formula | C15H29N2+ |
| Molecular Weight | 237.41 g/mol |
| Exact Mass | 237.23 |
| IUPAC Name | (3-butan-2-yl-2-methylhepta-2,4-dienimidoyl)-trimethylazanium |
| SMILES | [H]/N=C(/C(C)=C(C=CCC)C(C)CC)[N+](C)(C)C |
| InChI | InChI=1S/C15H29N2/c1-8-10-11-14(12(3)9-2)13(4)15(16)17(5,6)7/h10-12,16H,8-9H2,1-7H3/q+1/b11-10?,14-13?,16-15- |
| InChIKey | UJJUAWZXXPBXFH-BQFSRGSASA-N |
| XLogP | 4.00 |
| TPSA | 23.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.41 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|