C10H16N2 — CID 142083031
N,N,2-trimethylcyclohexa-1,5-diene-1-carboximidamide (PubChem CID 142083031) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is N,N,2-trimethylcyclohexa-1,5-diene-1-carboximidamide.
| Compound Name | N,N,2-trimethylcyclohexa-1,5-diene-1-carboximidamide |
|---|---|
| PubChem CID | 142083031 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | N,N,2-trimethylcyclohexa-1,5-diene-1-carboximidamide |
| SMILES | [H]/N=C(/C1=C(C)CCC=C1)N(C)C |
| InChI | InChI=1S/C10H16N2/c1-8-6-4-5-7-9(8)10(11)12(2)3/h5,7,11H,4,6H2,1-3H3/b11-10- |
| InChIKey | XCYTXKJNWSCDIS-KHPPLWFESA-N |
| XLogP | 2.19 |
| TPSA | 27.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|