C9H16N2 — CID 143671547
cyclohexa-1,5-diene-1-carboximidamide;ethane (PubChem CID 143671547) has the molecular formula C9H16N2 and a molecular weight of 152.24 g/mol. Its IUPAC name is cyclohexa-1,5-diene-1-carboximidamide;ethane.
| Compound Name | cyclohexa-1,5-diene-1-carboximidamide;ethane |
|---|---|
| PubChem CID | 143671547 |
| Molecular Formula | C9H16N2 |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.13 |
| IUPAC Name | cyclohexa-1,5-diene-1-carboximidamide;ethane |
| SMILES | CC.[H]/N=C(\N)C1=CCCC=C1 |
| InChI | InChI=1S/C7H10N2.C2H6/c8-7(9)6-4-2-1-3-5-6;1-2/h2,4-5H,1,3H2,(H3,8,9);1-2H3 |
| InChIKey | SLWXLHUMVRAKRV-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|