C17H21FN2 — CID 123653519
(2Z)-3-(5-fluoro-2-methylcyclohepta-1,4,6-trien-1-yl)-4-methyl-2-prop-1-enylpenta-2,4-dienimidamide (PubChem CID 123653519) has the molecular formula C17H21FN2 and a molecular weight of 272.37 g/mol. Its IUPAC name is (2Z)-3-(5-fluoro-2-methylcyclohepta-1,4,6-trien-1-yl)-4-methyl-2-prop-1-enylpenta-2,4-dienimidamide.
| Compound Name | (2Z)-3-(5-fluoro-2-methylcyclohepta-1,4,6-trien-1-yl)-4-methyl-2-prop-1-enylpenta-2,4-dienimidamide |
|---|---|
| PubChem CID | 123653519 |
| Molecular Formula | C17H21FN2 |
| Molecular Weight | 272.37 g/mol |
| Exact Mass | 272.17 |
| IUPAC Name | (2Z)-3-(5-fluoro-2-methylcyclohepta-1,4,6-trien-1-yl)-4-methyl-2-prop-1-enylpenta-2,4-dienimidamide |
| SMILES | [H]/N=C(N)/C(C=CC)=C(/C(=C)C)C1=C(C)CC=C(F)C=C1 |
| InChI | InChI=1S/C17H21FN2/c1-5-6-15(17(19)20)16(11(2)3)14-10-9-13(18)8-7-12(14)4/h5-6,8-10H,2,7H2,1,3-4H3,(H3,19,20)/b6-5?,16-15- |
| InChIKey | LAHBISGZBFAYCG-QXMAESGTSA-N |
| XLogP | 4.50 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.37 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|