C11H20N2 — CID 142070553
ethane;(2E,3Z,5Z)-2-ethylidenehepta-3,5-dienimidamide (PubChem CID 142070553) has the molecular formula C11H20N2 and a molecular weight of 180.29 g/mol. Its IUPAC name is ethane;(2E,3Z,5Z)-2-ethylidenehepta-3,5-dienimidamide.
| Compound Name | ethane;(2E,3Z,5Z)-2-ethylidenehepta-3,5-dienimidamide |
|---|---|
| PubChem CID | 142070553 |
| Molecular Formula | C11H20N2 |
| Molecular Weight | 180.29 g/mol |
| Exact Mass | 180.16 |
| IUPAC Name | ethane;(2E,3Z,5Z)-2-ethylidenehepta-3,5-dienimidamide |
| SMILES | CC.[H]/N=C(N)/C(/C=C\C=C/C)=C/C |
| InChI | InChI=1S/C9H14N2.C2H6/c1-3-5-6-7-8(4-2)9(10)11;1-2/h3-7H,1-2H3,(H3,10,11);1-2H3/b5-3-,7-6-,8-4+; |
| InChIKey | ZZURNNRICLADRC-ZGHSNMEGSA-N |
| XLogP | 3.03 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.29 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|