About benzenecarboximidamide;tungsten
benzenecarboximidamide;tungsten (PubChem CID 58182739) has the molecular formula C7H7N2W-
and a molecular weight of 302.99 g/mol. Its IUPAC name is benzenecarboximidamide;tungsten.
Molecular Properties
| Compound Name | benzenecarboximidamide;tungsten |
| PubChem CID | 58182739 |
| Molecular Formula | C7H7N2W- |
| Molecular Weight | 302.99 g/mol |
| Exact Mass | 303.01 |
| IUPAC Name | benzenecarboximidamide;tungsten |
| SMILES | [H]/N=C(\N)c1[c-]cccc1.[W] |
| InChI | InChI=1S/C7H7N2.W/c8-7(9)6-4-2-1-3-5-6;/h1-4H,(H3,8,9);/q-1; |
| InChIKey | VBSHXSUGRBAMRF-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 302.99 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze benzenecarboximidamide;tungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzenecarboximidamide;tungsten?
The IUPAC name of benzenecarboximidamide;tungsten (CID 58182739) is benzenecarboximidamide;tungsten.
What is the SMILES notation for benzenecarboximidamide;tungsten?
The canonical SMILES for benzenecarboximidamide;tungsten is [H]/N=C(\N)c1[c-]cccc1.[W].
What is the InChIKey of benzenecarboximidamide;tungsten?
The InChIKey is VBSHXSUGRBAMRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N2.W/c8-7(9)6-4-2-1-3-5-6;/h1-4H,(H3,8,9);/q-1;.
What are the key properties of benzenecarboximidamide;tungsten?
benzenecarboximidamide;tungsten has a molecular weight of 302.99 g/mol, XLogP of 0.77, 1 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzenecarboximidamide;tungsten is sourced from PubChem (CID 58182739), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).