C7H8N2 — CID 132595472
[amino(cyclohexa-1,3,4-trien-1-yl)methylidene]azanium (PubChem CID 132595472) has the molecular formula C7H8N2 and a molecular weight of 120.15 g/mol. Its IUPAC name is [amino(cyclohexa-1,3,4-trien-1-yl)methylidene]azanium.
| Compound Name | [amino(cyclohexa-1,3,4-trien-1-yl)methylidene]azanium |
|---|---|
| PubChem CID | 132595472 |
| Molecular Formula | C7H8N2 |
| Molecular Weight | 120.15 g/mol |
| Exact Mass | 120.07 |
| IUPAC Name | [amino(cyclohexa-1,3,4-trien-1-yl)methylidene]azanium |
| SMILES | NC(=[NH2+])C1=CC=C=C[CH-]1 |
| InChI | InChI=1S/C7H7N2/c8-7(9)6-4-2-1-3-5-6/h2-5H,(H3,8,9)/q-1/p+1 |
| InChIKey | QEANAYPRUXDYDH-UHFFFAOYSA-O |
| XLogP | -1.04 |
| TPSA | 51.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 120.15 |
| LogP ≤ 5 | -1.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|