C7H9FN2 — CID 18759979
6-fluorocyclohexa-1,5-diene-1-carboximidamide (PubChem CID 18759979) has the molecular formula C7H9FN2 and a molecular weight of 140.16 g/mol. Its IUPAC name is 6-fluorocyclohexa-1,5-diene-1-carboximidamide.
| Compound Name | 6-fluorocyclohexa-1,5-diene-1-carboximidamide |
|---|---|
| PubChem CID | 18759979 |
| Molecular Formula | C7H9FN2 |
| Molecular Weight | 140.16 g/mol |
| Exact Mass | 140.07 |
| IUPAC Name | 6-fluorocyclohexa-1,5-diene-1-carboximidamide |
| SMILES | [H]/N=C(\N)C1=CCCC=C1F |
| InChI | InChI=1S/C7H9FN2/c8-6-4-2-1-3-5(6)7(9)10/h3-4H,1-2H2,(H3,9,10) |
| InChIKey | DUVIVCAMVSCQKL-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 140.16 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|