C9H12F2N2 — CID 145092953
2,3-difluoro-4,4-dimethylcyclohexa-1,5-diene-1-carboximidamide (PubChem CID 145092953) has the molecular formula C9H12F2N2 and a molecular weight of 186.20 g/mol. Its IUPAC name is 2,3-difluoro-4,4-dimethylcyclohexa-1,5-diene-1-carboximidamide.
| Compound Name | 2,3-difluoro-4,4-dimethylcyclohexa-1,5-diene-1-carboximidamide |
|---|---|
| PubChem CID | 145092953 |
| Molecular Formula | C9H12F2N2 |
| Molecular Weight | 186.20 g/mol |
| Exact Mass | 186.10 |
| IUPAC Name | 2,3-difluoro-4,4-dimethylcyclohexa-1,5-diene-1-carboximidamide |
| SMILES | [H]/N=C(\N)C1=C(F)C(F)C(C)(C)C=C1 |
| InChI | InChI=1S/C9H12F2N2/c1-9(2)4-3-5(8(12)13)6(10)7(9)11/h3-4,7H,1-2H3,(H3,12,13) |
| InChIKey | GCLJIZHECJCXBW-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 49.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 186.20 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|