C12H22N2 — CID 145143507
(E,4R)-N',3,4-trimethyl-2-[(Z)-prop-1-enyl]hex-2-enimidamide (PubChem CID 145143507) has the molecular formula C12H22N2 and a molecular weight of 194.32 g/mol. Its IUPAC name is (E,4R)-N',3,4-trimethyl-2-[(Z)-prop-1-enyl]hex-2-enimidamide.
| Compound Name | (E,4R)-N',3,4-trimethyl-2-[(Z)-prop-1-enyl]hex-2-enimidamide |
|---|---|
| PubChem CID | 145143507 |
| Molecular Formula | C12H22N2 |
| Molecular Weight | 194.32 g/mol |
| Exact Mass | 194.18 |
| IUPAC Name | (E,4R)-N',3,4-trimethyl-2-[(Z)-prop-1-enyl]hex-2-enimidamide |
| SMILES | C/C=C\C(\C(N)=N\C)=C(\C)[C@H](C)CC |
| InChI | InChI=1S/C12H22N2/c1-6-8-11(12(13)14-5)10(4)9(3)7-2/h6,8-9H,7H2,1-5H3,(H2,13,14)/b8-6-,11-10+/t9-/m1/s1 |
| InChIKey | VFJOKMMLPMZBAU-UBTSWOMESA-N |
| XLogP | 2.91 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 194.32 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|