C16H26N2 — CID 126593792
(Z,2Z)-N'-ethenyl-5,6-dimethyl-2-[(E)-pent-3-en-2-ylidene]hept-3-enimidamide (PubChem CID 126593792) has the molecular formula C16H26N2 and a molecular weight of 246.40 g/mol. Its IUPAC name is (Z,2Z)-N'-ethenyl-5,6-dimethyl-2-[(E)-pent-3-en-2-ylidene]hept-3-enimidamide.
| Compound Name | (Z,2Z)-N'-ethenyl-5,6-dimethyl-2-[(E)-pent-3-en-2-ylidene]hept-3-enimidamide |
|---|---|
| PubChem CID | 126593792 |
| Molecular Formula | C16H26N2 |
| Molecular Weight | 246.40 g/mol |
| Exact Mass | 246.21 |
| IUPAC Name | (Z,2Z)-N'-ethenyl-5,6-dimethyl-2-[(E)-pent-3-en-2-ylidene]hept-3-enimidamide |
| SMILES | C=C/N=C(N)/C(/C=C\C(C)C(C)C)=C(C)\C=C\C |
| InChI | InChI=1S/C16H26N2/c1-7-9-14(6)15(16(17)18-8-2)11-10-13(5)12(3)4/h7-13H,2H2,1,3-6H3,(H2,17,18)/b9-7+,11-10-,15-14- |
| InChIKey | OLNUWZSKKLFIFA-OBMJAVNLSA-N |
| XLogP | 4.23 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.40 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|