C24H31N3 — CID 129142229
(2E)-N-[(3Z)-1-amino-2-methylidenehexa-3,5-dienylidene]-N'-(cyclohepta-2,4,6-trien-1-ylmethyl)-2-methylocta-2,7-dienimidamide (PubChem CID 129142229) has the molecular formula C24H31N3 and a molecular weight of 361.53 g/mol. Its IUPAC name is (2E)-N-[(3Z)-1-amino-2-methylidenehexa-3,5-dienylidene]-N'-(cyclohepta-2,4,6-trien-1-ylmethyl)-2-methylocta-2,7-dienimidamide.
| Compound Name | (2E)-N-[(3Z)-1-amino-2-methylidenehexa-3,5-dienylidene]-N'-(cyclohepta-2,4,6-trien-1-ylmethyl)-2-methylocta-2,7-dienimidamide |
|---|---|
| PubChem CID | 129142229 |
| Molecular Formula | C24H31N3 |
| Molecular Weight | 361.53 g/mol |
| Exact Mass | 361.25 |
| IUPAC Name | (2E)-N-[(3Z)-1-amino-2-methylidenehexa-3,5-dienylidene]-N'-(cyclohepta-2,4,6-trien-1-ylmethyl)-2-methylocta-2,7-dienimidamide |
| SMILES | C=C/C=C\C(=C)/C(N)=N\C(=N/CC1C=CC=CC=C1)\C(C)=C\CCCC=C |
| InChI | InChI=1S/C24H31N3/c1-5-7-9-12-16-21(4)24(27-23(25)20(3)15-8-6-2)26-19-22-17-13-10-11-14-18-22/h5-6,8,10-11,13-18,22H,1-3,7,9,12,19H2,4H3,(H2,25,26,27)/b15-8-,21-16+ |
| InChIKey | PZKVSIWFWBMLKP-XTIDLYJWSA-N |
| XLogP | 5.64 |
| TPSA | 50.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.53 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|