C14H20F2N2O — CID 123910824
1-(3,3-difluorocyclopentyl)-3-ethyl-5-(oxolan-3-yl)pyrazole (PubChem CID 123910824) has the molecular formula C14H20F2N2O and a molecular weight of 270.32 g/mol. Its IUPAC name is 1-(3,3-difluorocyclopentyl)-3-ethyl-5-(oxolan-3-yl)pyrazole.
| Compound Name | 1-(3,3-difluorocyclopentyl)-3-ethyl-5-(oxolan-3-yl)pyrazole |
|---|---|
| PubChem CID | 123910824 |
| Molecular Formula | C14H20F2N2O |
| Molecular Weight | 270.32 g/mol |
| Exact Mass | 270.15 |
| IUPAC Name | 1-(3,3-difluorocyclopentyl)-3-ethyl-5-(oxolan-3-yl)pyrazole |
| SMILES | CCc1cc(C2CCOC2)n(C2CCC(F)(F)C2)n1 |
| InChI | InChI=1S/C14H20F2N2O/c1-2-11-7-13(10-4-6-19-9-10)18(17-11)12-3-5-14(15,16)8-12/h7,10,12H,2-6,8-9H2,1H3 |
| InChIKey | PEWZFNCSCMIETI-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.32 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |