C12H15F2IN2O — CID 90286610
1-(3,3-difluorocyclopentyl)-3-iodo-5-(oxolan-3-yl)pyrazole (PubChem CID 90286610) has the molecular formula C12H15F2IN2O and a molecular weight of 368.17 g/mol. Its IUPAC name is 1-(3,3-difluorocyclopentyl)-3-iodo-5-(oxolan-3-yl)pyrazole.
| Compound Name | 1-(3,3-difluorocyclopentyl)-3-iodo-5-(oxolan-3-yl)pyrazole |
|---|---|
| PubChem CID | 90286610 |
| Molecular Formula | C12H15F2IN2O |
| Molecular Weight | 368.17 g/mol |
| Exact Mass | 368.02 |
| IUPAC Name | 1-(3,3-difluorocyclopentyl)-3-iodo-5-(oxolan-3-yl)pyrazole |
| SMILES | FC1(F)CCC(n2nc(I)cc2C2CCOC2)C1 |
| InChI | InChI=1S/C12H15F2IN2O/c13-12(14)3-1-9(6-12)17-10(5-11(15)16-17)8-2-4-18-7-8/h5,8-9H,1-4,6-7H2 |
| InChIKey | HOUASDGGUXUOSL-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.17 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|