C13H21NO2 — CID 123912105
2,4,6-trimethylhepta-2,4,6-trien-3-yl N,N-dimethylcarbamate (PubChem CID 123912105) has the molecular formula C13H21NO2 and a molecular weight of 223.32 g/mol. Its IUPAC name is 2,4,6-trimethylhepta-2,4,6-trien-3-yl N,N-dimethylcarbamate.
| Compound Name | 2,4,6-trimethylhepta-2,4,6-trien-3-yl N,N-dimethylcarbamate |
|---|---|
| PubChem CID | 123912105 |
| Molecular Formula | C13H21NO2 |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.16 |
| IUPAC Name | 2,4,6-trimethylhepta-2,4,6-trien-3-yl N,N-dimethylcarbamate |
| SMILES | C=C(C)C=C(C)C(OC(=O)N(C)C)=C(C)C |
| InChI | InChI=1S/C13H21NO2/c1-9(2)8-11(5)12(10(3)4)16-13(15)14(6)7/h8H,1H2,2-7H3 |
| InChIKey | KLHVVFFHQDJXQW-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|