C15H32N2 — CID 123912194
4-[(butan-2-ylideneamino)methyl]-2-ethyl-2,4-dimethylhexan-1-amine (PubChem CID 123912194) has the molecular formula C15H32N2 and a molecular weight of 240.43 g/mol. Its IUPAC name is 4-[(butan-2-ylideneamino)methyl]-2-ethyl-2,4-dimethylhexan-1-amine.
| Compound Name | 4-[(butan-2-ylideneamino)methyl]-2-ethyl-2,4-dimethylhexan-1-amine |
|---|---|
| PubChem CID | 123912194 |
| Molecular Formula | C15H32N2 |
| Molecular Weight | 240.43 g/mol |
| Exact Mass | 240.26 |
| IUPAC Name | 4-[(butan-2-ylideneamino)methyl]-2-ethyl-2,4-dimethylhexan-1-amine |
| SMILES | CC/C(C)=N/CC(C)(CC)CC(C)(CC)CN |
| InChI | InChI=1S/C15H32N2/c1-7-13(4)17-12-15(6,9-3)10-14(5,8-2)11-16/h7-12,16H2,1-6H3/b17-13+ |
| InChIKey | IOAOACXUMGVWQB-GHRIWEEISA-N |
| XLogP | 4.04 |
| TPSA | 38.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.43 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|