About N-(5-amino-2,4,4-trimethylpentan-2-yl)-N-methylethanimidamide
N-(5-amino-2,4,4-trimethylpentan-2-yl)-N-methylethanimidamide (PubChem CID 126732276) has the molecular formula C11H25N3
and a molecular weight of 199.34 g/mol. Its IUPAC name is N-(5-amino-2,4,4-trimethylpentan-2-yl)-N-methylethanimidamide.
Molecular Properties
| Compound Name | N-(5-amino-2,4,4-trimethylpentan-2-yl)-N-methylethanimidamide |
| PubChem CID | 126732276 |
| Molecular Formula | C11H25N3 |
| Molecular Weight | 199.34 g/mol |
| Exact Mass | 199.20 |
| IUPAC Name | N-(5-amino-2,4,4-trimethylpentan-2-yl)-N-methylethanimidamide |
| SMILES | [H]/N=C(\C)N(C)C(C)(C)CC(C)(C)CN |
| InChI | InChI=1S/C11H25N3/c1-9(13)14(6)11(4,5)7-10(2,3)8-12/h13H,7-8,12H2,1-6H3/b13-9+ |
| InChIKey | ZYPJSIDVECVETO-UKTHLTGXSA-N |
| XLogP | 2.07 |
| TPSA | 53.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 199.34 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze N-(5-amino-2,4,4-trimethylpentan-2-yl)-N-methylethanimidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(5-amino-2,4,4-trimethylpentan-2-yl)-N-methylethanimidamide?
The IUPAC name of N-(5-amino-2,4,4-trimethylpentan-2-yl)-N-methylethanimidamide (CID 126732276) is N-(5-amino-2,4,4-trimethylpentan-2-yl)-N-methylethanimidamide.
What is the SMILES notation for N-(5-amino-2,4,4-trimethylpentan-2-yl)-N-methylethanimidamide?
The canonical SMILES for N-(5-amino-2,4,4-trimethylpentan-2-yl)-N-methylethanimidamide is [H]/N=C(\C)N(C)C(C)(C)CC(C)(C)CN.
What is the InChIKey of N-(5-amino-2,4,4-trimethylpentan-2-yl)-N-methylethanimidamide?
The InChIKey is ZYPJSIDVECVETO-UKTHLTGXSA-N. The full InChI is InChI=1S/C11H25N3/c1-9(13)14(6)11(4,5)7-10(2,3)8-12/h13H,7-8,12H2,1-6H3/b13-9+.
What are the key properties of N-(5-amino-2,4,4-trimethylpentan-2-yl)-N-methylethanimidamide?
N-(5-amino-2,4,4-trimethylpentan-2-yl)-N-methylethanimidamide has a molecular weight of 199.34 g/mol, XLogP of 2.07, 4 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(5-amino-2,4,4-trimethylpentan-2-yl)-N-methylethanimidamide is sourced from PubChem (CID 126732276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).