C22H22N6O2S — CID 123912466
5-[8-[4-(4-methylpiperazin-1-yl)anilino]imidazo[1,2-a]pyrazin-5-yl]thiophene-3-carboxylic acid (PubChem CID 123912466) has the molecular formula C22H22N6O2S and a molecular weight of 434.53 g/mol. Its IUPAC name is 5-[8-[4-(4-methylpiperazin-1-yl)anilino]imidazo[1,2-a]pyrazin-5-yl]thiophene-3-carboxylic acid.
| Compound Name | 5-[8-[4-(4-methylpiperazin-1-yl)anilino]imidazo[1,2-a]pyrazin-5-yl]thiophene-3-carboxylic acid |
|---|---|
| PubChem CID | 123912466 |
| Molecular Formula | C22H22N6O2S |
| Molecular Weight | 434.53 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | 5-[8-[4-(4-methylpiperazin-1-yl)anilino]imidazo[1,2-a]pyrazin-5-yl]thiophene-3-carboxylic acid |
| SMILES | CN1CCN(c2ccc(Nc3ncc(-c4cc(C(=O)O)cs4)n4ccnc34)cc2)CC1 |
| InChI | InChI=1S/C22H22N6O2S/c1-26-8-10-27(11-9-26)17-4-2-16(3-5-17)25-20-21-23-6-7-28(21)18(13-24-20)19-12-15(14-31-19)22(29)30/h2-7,12-14H,8-11H2,1H3,(H,24,25)(H,29,30) |
| InChIKey | MYMBFPIUNUOWID-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 86.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.53 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|