C8H9FN2 — CID 123913279
4-(4-fluorobuta-1,3-dien-2-yl)-1-methylpyrazole (PubChem CID 123913279) has the molecular formula C8H9FN2 and a molecular weight of 152.17 g/mol. Its IUPAC name is 4-(4-fluorobuta-1,3-dien-2-yl)-1-methylpyrazole.
| Compound Name | 4-(4-fluorobuta-1,3-dien-2-yl)-1-methylpyrazole |
|---|---|
| PubChem CID | 123913279 |
| Molecular Formula | C8H9FN2 |
| Molecular Weight | 152.17 g/mol |
| Exact Mass | 152.07 |
| IUPAC Name | 4-(4-fluorobuta-1,3-dien-2-yl)-1-methylpyrazole |
| SMILES | C=C(C=CF)c1cnn(C)c1 |
| InChI | InChI=1S/C8H9FN2/c1-7(3-4-9)8-5-10-11(2)6-8/h3-6H,1H2,2H3 |
| InChIKey | APRMNSIBYGLSFF-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 17.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.17 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|