C11H20N2O2 — CID 123913790
2-amino-3-methoxy-N-(2-methylhexa-2,4-dienyl)propanamide (PubChem CID 123913790) has the molecular formula C11H20N2O2 and a molecular weight of 212.29 g/mol. Its IUPAC name is 2-amino-3-methoxy-N-(2-methylhexa-2,4-dienyl)propanamide.
| Compound Name | 2-amino-3-methoxy-N-(2-methylhexa-2,4-dienyl)propanamide |
|---|---|
| PubChem CID | 123913790 |
| Molecular Formula | C11H20N2O2 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.15 |
| IUPAC Name | 2-amino-3-methoxy-N-(2-methylhexa-2,4-dienyl)propanamide |
| SMILES | CC=CC=C(C)CNC(=O)C(N)COC |
| InChI | InChI=1S/C11H20N2O2/c1-4-5-6-9(2)7-13-11(14)10(12)8-15-3/h4-6,10H,7-8,12H2,1-3H3,(H,13,14) |
| InChIKey | YJOBPWRJFRDOHJ-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|