C10H19N3O4 — CID 123914126
[[(2S)-1-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]propylidene]amino] acetate (PubChem CID 123914126) has the molecular formula C10H19N3O4 and a molecular weight of 245.28 g/mol. Its IUPAC name is [[(2S)-1-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]propylidene]amino] acetate.
| Compound Name | [[(2S)-1-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]propylidene]amino] acetate |
|---|---|
| PubChem CID | 123914126 |
| Molecular Formula | C10H19N3O4 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | [[(2S)-1-amino-2-[(2-methylpropan-2-yl)oxycarbonylamino]propylidene]amino] acetate |
| SMILES | CC(=O)ON=C(N)[C@H](C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C10H19N3O4/c1-6(8(11)13-17-7(2)14)12-9(15)16-10(3,4)5/h6H,1-5H3,(H2,11,13)(H,12,15)/t6-/m0/s1 |
| InChIKey | IAEOQHQGBLPWNP-LURJTMIESA-N |
| XLogP | 0.73 |
| TPSA | 103.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|